C13H24N8O2 — CID 22526414
6-(2-tert-butylhydrazinyl)-N-(4-methylpiperazin-1-yl)-5-nitropyrimidin-4-amine (PubChem CID 22526414) has the molecular formula C13H24N8O2 and a molecular weight of 324.39 g/mol. Its IUPAC name is 6-(2-tert-butylhydrazinyl)-N-(4-methylpiperazin-1-yl)-5-nitropyrimidin-4-amine.
| Compound Name | 6-(2-tert-butylhydrazinyl)-N-(4-methylpiperazin-1-yl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 22526414 |
| Molecular Formula | C13H24N8O2 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 6-(2-tert-butylhydrazinyl)-N-(4-methylpiperazin-1-yl)-5-nitropyrimidin-4-amine |
| SMILES | CN1CCN(Nc2ncnc(NNC(C)(C)C)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C13H24N8O2/c1-13(2,3)18-16-11-10(21(22)23)12(15-9-14-11)17-20-7-5-19(4)6-8-20/h9,18H,5-8H2,1-4H3,(H2,14,15,16,17) |
| InChIKey | GULUMDXWIUPZJL-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 111.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|