C13H17N9O2 — CID 23493285
2-[cyanomethyl-[6-[(4-methylpiperazin-1-yl)amino]-5-nitropyrimidin-4-yl]amino]acetonitrile (PubChem CID 23493285) has the molecular formula C13H17N9O2 and a molecular weight of 331.34 g/mol. Its IUPAC name is 2-[cyanomethyl-[6-[(4-methylpiperazin-1-yl)amino]-5-nitropyrimidin-4-yl]amino]acetonitrile.
| Compound Name | 2-[cyanomethyl-[6-[(4-methylpiperazin-1-yl)amino]-5-nitropyrimidin-4-yl]amino]acetonitrile |
|---|---|
| PubChem CID | 23493285 |
| Molecular Formula | C13H17N9O2 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 2-[cyanomethyl-[6-[(4-methylpiperazin-1-yl)amino]-5-nitropyrimidin-4-yl]amino]acetonitrile |
| SMILES | CN1CCN(Nc2ncnc(N(CC#N)CC#N)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C13H17N9O2/c1-19-6-8-21(9-7-19)18-12-11(22(23)24)13(17-10-16-12)20(4-2-14)5-3-15/h10H,4-9H2,1H3,(H,16,17,18) |
| InChIKey | ZMRUUFIYWARMEL-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 138.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|