C17H23N7O2 — CID 23482643
6-N-(2-ethylphenyl)-4-N-(4-methylpiperazin-1-yl)-5-nitropyrimidine-4,6-diamine (PubChem CID 23482643) has the molecular formula C17H23N7O2 and a molecular weight of 357.42 g/mol. Its IUPAC name is 6-N-(2-ethylphenyl)-4-N-(4-methylpiperazin-1-yl)-5-nitropyrimidine-4,6-diamine.
| Compound Name | 6-N-(2-ethylphenyl)-4-N-(4-methylpiperazin-1-yl)-5-nitropyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 23482643 |
| Molecular Formula | C17H23N7O2 |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 6-N-(2-ethylphenyl)-4-N-(4-methylpiperazin-1-yl)-5-nitropyrimidine-4,6-diamine |
| SMILES | CCc1ccccc1Nc1ncnc(NN2CCN(C)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H23N7O2/c1-3-13-6-4-5-7-14(13)20-16-15(24(25)26)17(19-12-18-16)21-23-10-8-22(2)9-11-23/h4-7,12H,3,8-11H2,1-2H3,(H2,18,19,20,21) |
| InChIKey | JUXYOGQXQNNLBM-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 99.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|