C19H26N6O4 — CID 23490952
6-[4-(4-methoxyphenyl)piperazin-1-yl]-N-(1-methoxypropan-2-yl)-5-nitropyrimidin-4-amine (PubChem CID 23490952) has the molecular formula C19H26N6O4 and a molecular weight of 402.46 g/mol. Its IUPAC name is 6-[4-(4-methoxyphenyl)piperazin-1-yl]-N-(1-methoxypropan-2-yl)-5-nitropyrimidin-4-amine.
| Compound Name | 6-[4-(4-methoxyphenyl)piperazin-1-yl]-N-(1-methoxypropan-2-yl)-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 23490952 |
| Molecular Formula | C19H26N6O4 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 6-[4-(4-methoxyphenyl)piperazin-1-yl]-N-(1-methoxypropan-2-yl)-5-nitropyrimidin-4-amine |
| SMILES | COCC(C)Nc1ncnc(N2CCN(c3ccc(OC)cc3)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C19H26N6O4/c1-14(12-28-2)22-18-17(25(26)27)19(21-13-20-18)24-10-8-23(9-11-24)15-4-6-16(29-3)7-5-15/h4-7,13-14H,8-12H2,1-3H3,(H,20,21,22) |
| InChIKey | KBJULKSOGSGEPX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 105.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|