C21H23N7O3 — CID 23481252
6-[4-(4-methoxyphenyl)piperazin-1-yl]-5-nitro-N-(pyridin-3-ylmethyl)pyrimidin-4-amine (PubChem CID 23481252) has the molecular formula C21H23N7O3 and a molecular weight of 421.46 g/mol. Its IUPAC name is 6-[4-(4-methoxyphenyl)piperazin-1-yl]-5-nitro-N-(pyridin-3-ylmethyl)pyrimidin-4-amine.
| Compound Name | 6-[4-(4-methoxyphenyl)piperazin-1-yl]-5-nitro-N-(pyridin-3-ylmethyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 23481252 |
| Molecular Formula | C21H23N7O3 |
| Molecular Weight | 421.46 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 6-[4-(4-methoxyphenyl)piperazin-1-yl]-5-nitro-N-(pyridin-3-ylmethyl)pyrimidin-4-amine |
| SMILES | COc1ccc(N2CCN(c3ncnc(NCc4cccnc4)c3[N+](=O)[O-])CC2)cc1 |
| InChI | InChI=1S/C21H23N7O3/c1-31-18-6-4-17(5-7-18)26-9-11-27(12-10-26)21-19(28(29)30)20(24-15-25-21)23-14-16-3-2-8-22-13-16/h2-8,13,15H,9-12,14H2,1H3,(H,23,24,25) |
| InChIKey | YZZXJHQROLPFKB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 109.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|