C19H15F2N — CID 82096621
N-benzhydryl-2,4-difluoroaniline (PubChem CID 82096621) has the molecular formula C19H15F2N and a molecular weight of 295.33 g/mol. Its IUPAC name is N-benzhydryl-2,4-difluoroaniline.
| Compound Name | N-benzhydryl-2,4-difluoroaniline |
|---|---|
| PubChem CID | 82096621 |
| Molecular Formula | C19H15F2N |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | N-benzhydryl-2,4-difluoroaniline |
| SMILES | Fc1ccc(NC(c2ccccc2)c2ccccc2)c(F)c1 |
| InChI | InChI=1S/C19H15F2N/c20-16-11-12-18(17(21)13-16)22-19(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-13,19,22H |
| InChIKey | JQRSSZYCRGKDRB-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |