C18H16N4O4 — CID 22542231
4-N-(1,3-benzodioxol-5-yl)-6-(2-methoxyphenoxy)pyrimidine-4,5-diamine (PubChem CID 22542231) has the molecular formula C18H16N4O4 and a molecular weight of 352.35 g/mol. Its IUPAC name is 4-N-(1,3-benzodioxol-5-yl)-6-(2-methoxyphenoxy)pyrimidine-4,5-diamine.
| Compound Name | 4-N-(1,3-benzodioxol-5-yl)-6-(2-methoxyphenoxy)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 22542231 |
| Molecular Formula | C18H16N4O4 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | 4-N-(1,3-benzodioxol-5-yl)-6-(2-methoxyphenoxy)pyrimidine-4,5-diamine |
| SMILES | COc1ccccc1Oc1ncnc(Nc2ccc3c(c2)OCO3)c1N |
| InChI | InChI=1S/C18H16N4O4/c1-23-12-4-2-3-5-14(12)26-18-16(19)17(20-9-21-18)22-11-6-7-13-15(8-11)25-10-24-13/h2-9H,10,19H2,1H3,(H,20,21,22) |
| InChIKey | LAUBVVHBDZIYBA-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |