C28H39ClFN3O3 — CID 143731387
4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-ol;hexan-3-ol;methylcyclohexane (PubChem CID 143731387) has the molecular formula C28H39ClFN3O3 and a molecular weight of 520.09 g/mol. Its IUPAC name is 4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-ol;hexan-3-ol;methylcyclohexane.
| Compound Name | 4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-ol;hexan-3-ol;methylcyclohexane |
|---|---|
| PubChem CID | 143731387 |
| Molecular Formula | C28H39ClFN3O3 |
| Molecular Weight | 520.09 g/mol |
| Exact Mass | 519.27 |
| IUPAC Name | 4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-ol;hexan-3-ol;methylcyclohexane |
| SMILES | CC1CCCCC1.CCCC(O)CC.COc1cc2ncnc(Nc3cccc(Cl)c3F)c2cc1O |
| InChI | InChI=1S/C15H11ClFN3O2.C7H14.C6H14O/c1-22-13-6-11-8(5-12(13)21)15(19-7-18-11)20-10-4-2-3-9(16)14(10)17;1-7-5-3-2-4-6-7;1-3-5-6(7)4-2/h2-7,21H,1H3,(H,18,19,20);7H,2-6H2,1H3;6-7H,3-5H2,1-2H3 |
| InChIKey | OOIRNCZSXPTLQF-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.09 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |