C26H30ClFN5O4+ — CID 87838643
(2R,4S)-4-[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxy-1-methyl-1-(oxan-4-yl)pyrrolidin-1-ium-2-carboxamide (PubChem CID 87838643) has the molecular formula C26H30ClFN5O4+ and a molecular weight of 531.01 g/mol. Its IUPAC name is (2R,4S)-4-[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxy-1-methyl-1-(oxan-4-yl)pyrrolidin-1-ium-2-carboxamide.
| Compound Name | (2R,4S)-4-[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxy-1-methyl-1-(oxan-4-yl)pyrrolidin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 87838643 |
| Molecular Formula | C26H30ClFN5O4+ |
| Molecular Weight | 531.01 g/mol |
| Exact Mass | 530.20 |
| IUPAC Name | (2R,4S)-4-[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxy-1-methyl-1-(oxan-4-yl)pyrrolidin-1-ium-2-carboxamide |
| SMILES | COc1cc2ncnc(Nc3cccc(Cl)c3F)c2cc1O[C@H]1C[C@H](C(N)=O)[N+](C)(C2CCOCC2)C1 |
| InChI | InChI=1S/C26H29ClFN5O4/c1-33(15-6-8-36-9-7-15)13-16(10-21(33)25(29)34)37-23-11-17-20(12-22(23)35-2)30-14-31-26(17)32-19-5-3-4-18(27)24(19)28/h3-5,11-12,14-16,21H,6-10,13H2,1-2H3,(H2-,29,30,31,32,34)/p+1/t16-,21+,33?/m0/s1 |
| InChIKey | RGFKSDCNKGXTAA-XMGGTGQISA-O |
| XLogP | 3.81 |
| TPSA | 108.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.01 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|