C25H24ClFN5O3S+ — CID 87838316
(2R,4S)-4-[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxy-1-methyl-1-thiophen-3-ylpyrrolidin-1-ium-2-carboxamide (PubChem CID 87838316) has the molecular formula C25H24ClFN5O3S+ and a molecular weight of 529.02 g/mol. Its IUPAC name is (2R,4S)-4-[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxy-1-methyl-1-thiophen-3-ylpyrrolidin-1-ium-2-carboxamide.
| Compound Name | (2R,4S)-4-[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxy-1-methyl-1-thiophen-3-ylpyrrolidin-1-ium-2-carboxamide |
|---|---|
| PubChem CID | 87838316 |
| Molecular Formula | C25H24ClFN5O3S+ |
| Molecular Weight | 529.02 g/mol |
| Exact Mass | 528.13 |
| IUPAC Name | (2R,4S)-4-[4-(3-chloro-2-fluoroanilino)-7-methoxyquinazolin-6-yl]oxy-1-methyl-1-thiophen-3-ylpyrrolidin-1-ium-2-carboxamide |
| SMILES | COc1cc2ncnc(Nc3cccc(Cl)c3F)c2cc1O[C@H]1C[C@H](C(N)=O)[N+](C)(c2ccsc2)C1 |
| InChI | InChI=1S/C25H23ClFN5O3S/c1-32(14-6-7-36-12-14)11-15(8-20(32)24(28)33)35-22-9-16-19(10-21(22)34-2)29-13-30-25(16)31-18-5-3-4-17(26)23(18)27/h3-7,9-10,12-13,15,20H,8,11H2,1-2H3,(H2-,28,29,30,31,33)/p+1/t15-,20+,32?/m0/s1 |
| InChIKey | MEKRUTFPDJMSND-UVPVALSOSA-O |
| XLogP | 4.88 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.02 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|