C23H19ClFN5O2 — CID 156640030
N-(3-chloro-2-fluorophenyl)-7-[2-(7-methyl-7-azabicyclo[2.2.1]heptan-1-yl)ethynyl]-6-nitroquinazolin-4-amine (PubChem CID 156640030) has the molecular formula C23H19ClFN5O2 and a molecular weight of 451.89 g/mol. Its IUPAC name is N-(3-chloro-2-fluorophenyl)-7-[2-(7-methyl-7-azabicyclo[2.2.1]heptan-1-yl)ethynyl]-6-nitroquinazolin-4-amine.
| Compound Name | N-(3-chloro-2-fluorophenyl)-7-[2-(7-methyl-7-azabicyclo[2.2.1]heptan-1-yl)ethynyl]-6-nitroquinazolin-4-amine |
|---|---|
| PubChem CID | 156640030 |
| Molecular Formula | C23H19ClFN5O2 |
| Molecular Weight | 451.89 g/mol |
| Exact Mass | 451.12 |
| IUPAC Name | N-(3-chloro-2-fluorophenyl)-7-[2-(7-methyl-7-azabicyclo[2.2.1]heptan-1-yl)ethynyl]-6-nitroquinazolin-4-amine |
| SMILES | CN1C2CCC1(C#Cc1cc3ncnc(Nc4cccc(Cl)c4F)c3cc1[N+](=O)[O-])CC2 |
| InChI | InChI=1S/C23H19ClFN5O2/c1-29-15-6-9-23(29,10-7-15)8-5-14-11-19-16(12-20(14)30(31)32)22(27-13-26-19)28-18-4-2-3-17(24)21(18)25/h2-4,11-13,15H,6-7,9-10H2,1H3,(H,26,27,28) |
| InChIKey | PWDOJCZOYHJWRS-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.89 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|