C22H19ClFN5 — CID 156640089
4-N-(3-chloro-2-fluorophenyl)-7-[2-(3-methyl-3-azabicyclo[3.1.0]hexan-1-yl)ethynyl]quinazoline-4,6-diamine (PubChem CID 156640089) has the molecular formula C22H19ClFN5 and a molecular weight of 407.88 g/mol. Its IUPAC name is 4-N-(3-chloro-2-fluorophenyl)-7-[2-(3-methyl-3-azabicyclo[3.1.0]hexan-1-yl)ethynyl]quinazoline-4,6-diamine.
| Compound Name | 4-N-(3-chloro-2-fluorophenyl)-7-[2-(3-methyl-3-azabicyclo[3.1.0]hexan-1-yl)ethynyl]quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 156640089 |
| Molecular Formula | C22H19ClFN5 |
| Molecular Weight | 407.88 g/mol |
| Exact Mass | 407.13 |
| IUPAC Name | 4-N-(3-chloro-2-fluorophenyl)-7-[2-(3-methyl-3-azabicyclo[3.1.0]hexan-1-yl)ethynyl]quinazoline-4,6-diamine |
| SMILES | CN1CC2CC2(C#Cc2cc3ncnc(Nc4cccc(Cl)c4F)c3cc2N)C1 |
| InChI | InChI=1S/C22H19ClFN5/c1-29-10-14-9-22(14,11-29)6-5-13-7-19-15(8-17(13)25)21(27-12-26-19)28-18-4-2-3-16(23)20(18)24/h2-4,7-8,12,14H,9-11,25H2,1H3,(H,26,27,28) |
| InChIKey | UZSCHIFTGKHORQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.88 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|