C27H26ClFN4O — CID 167619378
1-[4-(3-chloro-2-fluoroanilino)-7-[2-[(3S)-1,3-dimethylpiperidin-3-yl]ethynyl]quinazolin-6-yl]but-3-en-2-one (PubChem CID 167619378) has the molecular formula C27H26ClFN4O and a molecular weight of 476.98 g/mol. Its IUPAC name is 1-[4-(3-chloro-2-fluoroanilino)-7-[2-[(3S)-1,3-dimethylpiperidin-3-yl]ethynyl]quinazolin-6-yl]but-3-en-2-one.
| Compound Name | 1-[4-(3-chloro-2-fluoroanilino)-7-[2-[(3S)-1,3-dimethylpiperidin-3-yl]ethynyl]quinazolin-6-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 167619378 |
| Molecular Formula | C27H26ClFN4O |
| Molecular Weight | 476.98 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 1-[4-(3-chloro-2-fluoroanilino)-7-[2-[(3S)-1,3-dimethylpiperidin-3-yl]ethynyl]quinazolin-6-yl]but-3-en-2-one |
| SMILES | C=CC(=O)Cc1cc2c(Nc3cccc(Cl)c3F)ncnc2cc1C#C[C@]1(C)CCCN(C)C1 |
| InChI | InChI=1S/C27H26ClFN4O/c1-4-20(34)13-19-14-21-24(15-18(19)9-11-27(2)10-6-12-33(3)16-27)30-17-31-26(21)32-23-8-5-7-22(28)25(23)29/h4-5,7-8,14-15,17H,1,6,10,12-13,16H2,2-3H3,(H,30,31,32)/t27-/m0/s1 |
| InChIKey | MFHCZKNBMOPGNZ-MHZLTWQESA-N |
| XLogP | 5.55 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.98 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|