C21H14ClF4N5O2 — CID 177254503
7-[2-[1-(3-chloro-2-fluorophenyl)-3-(trifluoromethyl)pyrrolidin-3-yl]ethynyl]-6-nitroquinazolin-4-amine (PubChem CID 177254503) has the molecular formula C21H14ClF4N5O2 and a molecular weight of 479.82 g/mol. Its IUPAC name is 7-[2-[1-(3-chloro-2-fluorophenyl)-3-(trifluoromethyl)pyrrolidin-3-yl]ethynyl]-6-nitroquinazolin-4-amine.
| Compound Name | 7-[2-[1-(3-chloro-2-fluorophenyl)-3-(trifluoromethyl)pyrrolidin-3-yl]ethynyl]-6-nitroquinazolin-4-amine |
|---|---|
| PubChem CID | 177254503 |
| Molecular Formula | C21H14ClF4N5O2 |
| Molecular Weight | 479.82 g/mol |
| Exact Mass | 479.08 |
| IUPAC Name | 7-[2-[1-(3-chloro-2-fluorophenyl)-3-(trifluoromethyl)pyrrolidin-3-yl]ethynyl]-6-nitroquinazolin-4-amine |
| SMILES | Nc1ncnc2cc(C#CC3(C(F)(F)F)CCN(c4cccc(Cl)c4F)C3)c([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C21H14ClF4N5O2/c22-14-2-1-3-16(18(14)23)30-7-6-20(10-30,21(24,25)26)5-4-12-8-15-13(9-17(12)31(32)33)19(27)29-11-28-15/h1-3,8-9,11H,6-7,10H2,(H2,27,28,29) |
| InChIKey | DXBJNGGBEOZNKP-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 98.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.82 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|