C27H34BrN6O4P — CID 173278934
4-[[4-(3-bromoanilino)quinazolin-6-yl]amino]-1-[4-(diethoxyphosphorylmethyl)piperazin-1-yl]but-2-en-1-one (PubChem CID 173278934) has the molecular formula C27H34BrN6O4P and a molecular weight of 617.49 g/mol. Its IUPAC name is 4-[[4-(3-bromoanilino)quinazolin-6-yl]amino]-1-[4-(diethoxyphosphorylmethyl)piperazin-1-yl]but-2-en-1-one.
| Compound Name | 4-[[4-(3-bromoanilino)quinazolin-6-yl]amino]-1-[4-(diethoxyphosphorylmethyl)piperazin-1-yl]but-2-en-1-one |
|---|---|
| PubChem CID | 173278934 |
| Molecular Formula | C27H34BrN6O4P |
| Molecular Weight | 617.49 g/mol |
| Exact Mass | 616.16 |
| IUPAC Name | 4-[[4-(3-bromoanilino)quinazolin-6-yl]amino]-1-[4-(diethoxyphosphorylmethyl)piperazin-1-yl]but-2-en-1-one |
| SMILES | CCOP(=O)(CN1CCN(C(=O)C=CCNc2ccc3ncnc(Nc4cccc(Br)c4)c3c2)CC1)OCC |
| InChI | InChI=1S/C27H34BrN6O4P/c1-3-37-39(36,38-4-2)20-33-13-15-34(16-14-33)26(35)9-6-12-29-22-10-11-25-24(18-22)27(31-19-30-25)32-23-8-5-7-21(28)17-23/h5-11,17-19,29H,3-4,12-16,20H2,1-2H3,(H,30,31,32) |
| InChIKey | GNZGGEGKFPQNEY-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.49 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|