C25H26BrN8O3+ — CID 75243949
[4-[[4-(3-bromoanilino)quinazolin-6-yl]amino]-4-oxobut-2-enyl]-dimethyl-[(1-methyl-4-nitroimidazol-2-yl)methyl]azanium (PubChem CID 75243949) has the molecular formula C25H26BrN8O3+ and a molecular weight of 566.44 g/mol. Its IUPAC name is [4-[[4-(3-bromoanilino)quinazolin-6-yl]amino]-4-oxobut-2-enyl]-dimethyl-[(1-methyl-4-nitroimidazol-2-yl)methyl]azanium.
| Compound Name | [4-[[4-(3-bromoanilino)quinazolin-6-yl]amino]-4-oxobut-2-enyl]-dimethyl-[(1-methyl-4-nitroimidazol-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 75243949 |
| Molecular Formula | C25H26BrN8O3+ |
| Molecular Weight | 566.44 g/mol |
| Exact Mass | 565.13 |
| IUPAC Name | [4-[[4-(3-bromoanilino)quinazolin-6-yl]amino]-4-oxobut-2-enyl]-dimethyl-[(1-methyl-4-nitroimidazol-2-yl)methyl]azanium |
| SMILES | Cn1cc([N+](=O)[O-])nc1C[N+](C)(C)CC=CC(=O)Nc1ccc2ncnc(Nc3cccc(Br)c3)c2c1 |
| InChI | InChI=1S/C25H25BrN8O3/c1-32-14-22(33(36)37)31-23(32)15-34(2,3)11-5-8-24(35)29-19-9-10-21-20(13-19)25(28-16-27-21)30-18-7-4-6-17(26)12-18/h4-10,12-14,16H,11,15H2,1-3H3,(H-,27,28,29,30,35)/p+1 |
| InChIKey | BTPLSIKGAWEYCG-UHFFFAOYSA-O |
| XLogP | 4.55 |
| TPSA | 127.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.44 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|