C28H26N9O3+ — CID 75244045
[4-[[4-(3-ethynylanilino)pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-[(2-ethynyl-3-methyl-5-nitroimidazol-4-yl)methyl]-dimethylazanium (PubChem CID 75244045) has the molecular formula C28H26N9O3+ and a molecular weight of 536.58 g/mol. Its IUPAC name is [4-[[4-(3-ethynylanilino)pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-[(2-ethynyl-3-methyl-5-nitroimidazol-4-yl)methyl]-dimethylazanium.
| Compound Name | [4-[[4-(3-ethynylanilino)pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-[(2-ethynyl-3-methyl-5-nitroimidazol-4-yl)methyl]-dimethylazanium |
|---|---|
| PubChem CID | 75244045 |
| Molecular Formula | C28H26N9O3+ |
| Molecular Weight | 536.58 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | [4-[[4-(3-ethynylanilino)pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-[(2-ethynyl-3-methyl-5-nitroimidazol-4-yl)methyl]-dimethylazanium |
| SMILES | C#Cc1cccc(Nc2ncnc3cnc(NC(=O)C=CC[N+](C)(C)Cc4c([N+](=O)[O-])nc(C#C)n4C)cc23)c1 |
| InChI | InChI=1S/C28H25N9O3/c1-6-19-10-8-11-20(14-19)32-27-21-15-24(29-16-22(21)30-18-31-27)33-26(38)12-9-13-37(4,5)17-23-28(36(39)40)34-25(7-2)35(23)3/h1-2,8-12,14-16,18H,13,17H2,3-5H3,(H-,29,30,31,32,33,38)/p+1 |
| InChIKey | SXZRINOVYNBVJS-UHFFFAOYSA-O |
| XLogP | 3.14 |
| TPSA | 140.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.58 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|