C25H23Cl2F3N9O3+ — CID 88851626
[(E)-4-[[4-(3,4-dichloroanilino)pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-dimethyl-[[3-methyl-5-nitro-2-(trifluoromethyl)imidazol-4-yl]methyl]azanium (PubChem CID 88851626) has the molecular formula C25H23Cl2F3N9O3+ and a molecular weight of 625.42 g/mol. Its IUPAC name is [(E)-4-[[4-(3,4-dichloroanilino)pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-dimethyl-[[3-methyl-5-nitro-2-(trifluoromethyl)imidazol-4-yl]methyl]azanium.
| Compound Name | [(E)-4-[[4-(3,4-dichloroanilino)pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-dimethyl-[[3-methyl-5-nitro-2-(trifluoromethyl)imidazol-4-yl]methyl]azanium |
|---|---|
| PubChem CID | 88851626 |
| Molecular Formula | C25H23Cl2F3N9O3+ |
| Molecular Weight | 625.42 g/mol |
| Exact Mass | 624.12 |
| IUPAC Name | [(E)-4-[[4-(3,4-dichloroanilino)pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-dimethyl-[[3-methyl-5-nitro-2-(trifluoromethyl)imidazol-4-yl]methyl]azanium |
| SMILES | Cn1c(C(F)(F)F)nc([N+](=O)[O-])c1C[N+](C)(C)C/C=C/C(=O)Nc1cc2c(Nc3ccc(Cl)c(Cl)c3)ncnc2cn1 |
| InChI | InChI=1S/C25H22Cl2F3N9O3/c1-37-19(23(38(41)42)36-24(37)25(28,29)30)12-39(2,3)8-4-5-21(40)35-20-10-15-18(11-31-20)32-13-33-22(15)34-14-6-7-16(26)17(27)9-14/h4-7,9-11,13H,8,12H2,1-3H3,(H-,31,32,33,34,35,40)/p+1/b5-4+ |
| InChIKey | YXTRTRPMMWQVKX-SNAWJCMRSA-O |
| XLogP | 5.51 |
| TPSA | 140.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.42 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|