C27H24Br2F3N9O3 — CID 51037879
[(E)-4-[[4-(4-bromo-3-ethynylanilino)pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-dimethyl-[[3-methyl-5-nitro-2-(trifluoromethyl)imidazol-4-yl]methyl]azanium bromide (PubChem CID 51037879) has the molecular formula C27H24Br2F3N9O3 and a molecular weight of 739.35 g/mol. Its IUPAC name is [(E)-4-[[4-(4-bromo-3-ethynylanilino)pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-dimethyl-[[3-methyl-5-nitro-2-(trifluoromethyl)imidazol-4-yl]methyl]azanium bromide.
| Compound Name | [(E)-4-[[4-(4-bromo-3-ethynylanilino)pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-dimethyl-[[3-methyl-5-nitro-2-(trifluoromethyl)imidazol-4-yl]methyl]azanium bromide |
|---|---|
| PubChem CID | 51037879 |
| Molecular Formula | C27H24Br2F3N9O3 |
| Molecular Weight | 739.35 g/mol |
| Exact Mass | 737.03 |
| IUPAC Name | [(E)-4-[[4-(4-bromo-3-ethynylanilino)pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-dimethyl-[[3-methyl-5-nitro-2-(trifluoromethyl)imidazol-4-yl]methyl]azanium bromide |
| SMILES | C#Cc1cc(Nc2ncnc3cnc(NC(=O)/C=C/C[N+](C)(C)Cc4c([N+](=O)[O-])nc(C(F)(F)F)n4C)cc23)ccc1Br.[Br-] |
| InChI | InChI=1S/C27H23BrF3N9O3.BrH/c1-5-16-11-17(8-9-19(16)28)35-24-18-12-22(32-13-20(18)33-15-34-24)36-23(41)7-6-10-40(3,4)14-21-25(39(42)43)37-26(38(21)2)27(29,30)31;/h1,6-9,11-13,15H,10,14H2,2-4H3,(H-,32,33,34,35,36,41);1H/b7-6+; |
| InChIKey | QQXKWTVLEMMRGG-UHDJGPCESA-N |
| XLogP | 1.95 |
| TPSA | 140.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|