C29H26ClN8O3+ — CID 163730801
[(E)-4-[[4-(4-chloro-3-ethynylanilino)pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-dimethyl-[(5-nitro-2-prop-1-ynyl-3H-pyrrol-4-yl)methyl]azanium (PubChem CID 163730801) has the molecular formula C29H26ClN8O3+ and a molecular weight of 570.03 g/mol. Its IUPAC name is [(E)-4-[[4-(4-chloro-3-ethynylanilino)pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-dimethyl-[(5-nitro-2-prop-1-ynyl-3H-pyrrol-4-yl)methyl]azanium.
| Compound Name | [(E)-4-[[4-(4-chloro-3-ethynylanilino)pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-dimethyl-[(5-nitro-2-prop-1-ynyl-3H-pyrrol-4-yl)methyl]azanium |
|---|---|
| PubChem CID | 163730801 |
| Molecular Formula | C29H26ClN8O3+ |
| Molecular Weight | 570.03 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | [(E)-4-[[4-(4-chloro-3-ethynylanilino)pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-dimethyl-[(5-nitro-2-prop-1-ynyl-3H-pyrrol-4-yl)methyl]azanium |
| SMILES | C#Cc1cc(Nc2ncnc3cnc(NC(=O)/C=C/C[N+](C)(C)CC4=C([N+](=O)[O-])N=C(C#CC)C4)cc23)ccc1Cl |
| InChI | InChI=1S/C29H25ClN8O3/c1-5-8-21-14-20(29(35-21)37(40)41)17-38(3,4)12-7-9-27(39)36-26-15-23-25(16-31-26)32-18-33-28(23)34-22-10-11-24(30)19(6-2)13-22/h2,7,9-11,13,15-16,18H,12,14,17H2,1,3-4H3,(H-,31,32,33,34,36,39)/p+1/b9-7+ |
| InChIKey | LTTPIXJJJHWEGO-VQHVLOKHSA-O |
| XLogP | 4.33 |
| TPSA | 135.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.03 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|