C24H25BrClN9O3 — CID 163597468
[(E)-4-[[4-(3-bromo-4-chloroanilino)pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-[[5-[hydroxy(oxido)amino]-3-methylimidazol-4-yl]methyl]-dimethylazanium (PubChem CID 163597468) has the molecular formula C24H25BrClN9O3 and a molecular weight of 602.88 g/mol. Its IUPAC name is [(E)-4-[[4-(3-bromo-4-chloroanilino)pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-[[5-[hydroxy(oxido)amino]-3-methylimidazol-4-yl]methyl]-dimethylazanium.
| Compound Name | [(E)-4-[[4-(3-bromo-4-chloroanilino)pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-[[5-[hydroxy(oxido)amino]-3-methylimidazol-4-yl]methyl]-dimethylazanium |
|---|---|
| PubChem CID | 163597468 |
| Molecular Formula | C24H25BrClN9O3 |
| Molecular Weight | 602.88 g/mol |
| Exact Mass | 601.10 |
| IUPAC Name | [(E)-4-[[4-(3-bromo-4-chloroanilino)pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-[[5-[hydroxy(oxido)amino]-3-methylimidazol-4-yl]methyl]-dimethylazanium |
| SMILES | Cn1cnc(N([O-])O)c1C[N+](C)(C)C/C=C/C(=O)Nc1cc2c(Nc3ccc(Cl)c(Br)c3)ncnc2cn1 |
| InChI | InChI=1S/C24H25BrClN9O3/c1-33-14-30-24(34(37)38)20(33)12-35(2,3)8-4-5-22(36)32-21-10-16-19(11-27-21)28-13-29-23(16)31-15-6-7-18(26)17(25)9-15/h4-7,9-11,13-14,37H,8,12H2,1-3H3,(H,27,32,36)(H,28,29,31)/b5-4+ |
| InChIKey | IOKYFOKMDVDTDP-SNAWJCMRSA-N |
| XLogP | 4.38 |
| TPSA | 144.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.88 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|