C24H23BrClN8O3+ — CID 163980263
[(E)-4-[[4-(4-bromo-3-chloroanilino)pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-dimethyl-[(5-nitro-3H-pyrrol-4-yl)methyl]azanium (PubChem CID 163980263) has the molecular formula C24H23BrClN8O3+ and a molecular weight of 586.86 g/mol. Its IUPAC name is [(E)-4-[[4-(4-bromo-3-chloroanilino)pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-dimethyl-[(5-nitro-3H-pyrrol-4-yl)methyl]azanium.
| Compound Name | [(E)-4-[[4-(4-bromo-3-chloroanilino)pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-dimethyl-[(5-nitro-3H-pyrrol-4-yl)methyl]azanium |
|---|---|
| PubChem CID | 163980263 |
| Molecular Formula | C24H23BrClN8O3+ |
| Molecular Weight | 586.86 g/mol |
| Exact Mass | 585.08 |
| IUPAC Name | [(E)-4-[[4-(4-bromo-3-chloroanilino)pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-dimethyl-[(5-nitro-3H-pyrrol-4-yl)methyl]azanium |
| SMILES | C[N+](C)(C/C=C/C(=O)Nc1cc2c(Nc3ccc(Br)c(Cl)c3)ncnc2cn1)CC1=C([N+](=O)[O-])N=CC1 |
| InChI | InChI=1S/C24H22BrClN8O3/c1-34(2,13-15-7-8-27-24(15)33(36)37)9-3-4-22(35)32-21-11-17-20(12-28-21)29-14-30-23(17)31-16-5-6-18(25)19(26)10-16/h3-6,8,10-12,14H,7,9,13H2,1-2H3,(H-,28,29,30,31,32,35)/p+1/b4-3+ |
| InChIKey | UBPZKOKSGKQCLD-ONEGZZNKSA-O |
| XLogP | 4.72 |
| TPSA | 135.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.86 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|