C32H30Cl2N7O4+ — CID 158501329
[(E)-5-[4-[3-chloro-4-[(3-chlorophenyl)methoxy]anilino]pyrido[3,4-d]pyrimidin-6-yl]-4-oxopent-2-enyl]-dimethyl-[(5-nitro-3H-pyrrol-4-yl)methyl]azanium (PubChem CID 158501329) has the molecular formula C32H30Cl2N7O4+ and a molecular weight of 647.54 g/mol. Its IUPAC name is [(E)-5-[4-[3-chloro-4-[(3-chlorophenyl)methoxy]anilino]pyrido[3,4-d]pyrimidin-6-yl]-4-oxopent-2-enyl]-dimethyl-[(5-nitro-3H-pyrrol-4-yl)methyl]azanium.
| Compound Name | [(E)-5-[4-[3-chloro-4-[(3-chlorophenyl)methoxy]anilino]pyrido[3,4-d]pyrimidin-6-yl]-4-oxopent-2-enyl]-dimethyl-[(5-nitro-3H-pyrrol-4-yl)methyl]azanium |
|---|---|
| PubChem CID | 158501329 |
| Molecular Formula | C32H30Cl2N7O4+ |
| Molecular Weight | 647.54 g/mol |
| Exact Mass | 646.17 |
| IUPAC Name | [(E)-5-[4-[3-chloro-4-[(3-chlorophenyl)methoxy]anilino]pyrido[3,4-d]pyrimidin-6-yl]-4-oxopent-2-enyl]-dimethyl-[(5-nitro-3H-pyrrol-4-yl)methyl]azanium |
| SMILES | C[N+](C)(C/C=C/C(=O)Cc1cc2c(Nc3ccc(OCc4cccc(Cl)c4)c(Cl)c3)ncnc2cn1)CC1=C([N+](=O)[O-])N=CC1 |
| InChI | InChI=1S/C32H30Cl2N7O4/c1-41(2,18-22-10-11-35-32(22)40(43)44)12-4-7-26(42)14-25-15-27-29(17-36-25)37-20-38-31(27)39-24-8-9-30(28(34)16-24)45-19-21-5-3-6-23(33)13-21/h3-9,11,13,15-17,20H,10,12,14,18-19H2,1-2H3,(H,37,38,39)/q+1/b7-4+ |
| InChIKey | CTJJTKNYYFLHJM-QPJJXVBHSA-N |
| XLogP | 6.36 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.54 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|