C30H30ClN10O4+ — CID 51038090
[(E)-4-[[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-dimethyl-[(3-methyl-5-nitroimidazol-4-yl)methyl]azanium (PubChem CID 51038090) has the molecular formula C30H30ClN10O4+ and a molecular weight of 630.09 g/mol. Its IUPAC name is [(E)-4-[[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-dimethyl-[(3-methyl-5-nitroimidazol-4-yl)methyl]azanium.
| Compound Name | [(E)-4-[[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-dimethyl-[(3-methyl-5-nitroimidazol-4-yl)methyl]azanium |
|---|---|
| PubChem CID | 51038090 |
| Molecular Formula | C30H30ClN10O4+ |
| Molecular Weight | 630.09 g/mol |
| Exact Mass | 629.21 |
| IUPAC Name | [(E)-4-[[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-dimethyl-[(3-methyl-5-nitroimidazol-4-yl)methyl]azanium |
| SMILES | Cn1cnc([N+](=O)[O-])c1C[N+](C)(C)C/C=C/C(=O)Nc1cc2c(Nc3ccc(OCc4ccccn4)c(Cl)c3)ncnc2cn1 |
| InChI | InChI=1S/C30H29ClN10O4/c1-39-19-36-30(40(43)44)25(39)16-41(2,3)12-6-8-28(42)38-27-14-22-24(15-33-27)34-18-35-29(22)37-20-9-10-26(23(31)13-20)45-17-21-7-4-5-11-32-21/h4-11,13-15,18-19H,12,16-17H2,1-3H3,(H-,33,34,35,37,38,42)/p+1/b8-6+ |
| InChIKey | HWXUWAZXXFCTLH-SOFGYWHQSA-O |
| XLogP | 4.81 |
| TPSA | 162.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.09 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|