C26H27ClFN8O4+ — CID 75243951
[4-[[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]amino]-4-oxobut-2-enyl]-dimethyl-[(3-methyl-5-nitroimidazol-4-yl)methyl]azanium (PubChem CID 75243951) has the molecular formula C26H27ClFN8O4+ and a molecular weight of 570.01 g/mol. Its IUPAC name is [4-[[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]amino]-4-oxobut-2-enyl]-dimethyl-[(3-methyl-5-nitroimidazol-4-yl)methyl]azanium.
| Compound Name | [4-[[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]amino]-4-oxobut-2-enyl]-dimethyl-[(3-methyl-5-nitroimidazol-4-yl)methyl]azanium |
|---|---|
| PubChem CID | 75243951 |
| Molecular Formula | C26H27ClFN8O4+ |
| Molecular Weight | 570.01 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | [4-[[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]amino]-4-oxobut-2-enyl]-dimethyl-[(3-methyl-5-nitroimidazol-4-yl)methyl]azanium |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1NC(=O)C=CC[N+](C)(C)Cc1c([N+](=O)[O-])ncn1C |
| InChI | InChI=1S/C26H26ClFN8O4/c1-34-15-31-26(35(38)39)22(34)13-36(2,3)9-5-6-24(37)33-21-11-17-20(12-23(21)40-4)29-14-30-25(17)32-16-7-8-19(28)18(27)10-16/h5-8,10-12,14-15H,9,13H2,1-4H3,(H-,29,30,32,33,37)/p+1 |
| InChIKey | AIAOQOVTBNCUOT-UHFFFAOYSA-O |
| XLogP | 4.59 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.01 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|