C31H31ClN9O4+ — CID 163437650
[(E)-4-[[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-dimethyl-[(2-methyl-5-nitro-3H-pyrrol-4-yl)methyl]azanium (PubChem CID 163437650) has the molecular formula C31H31ClN9O4+ and a molecular weight of 629.10 g/mol. Its IUPAC name is [(E)-4-[[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-dimethyl-[(2-methyl-5-nitro-3H-pyrrol-4-yl)methyl]azanium.
| Compound Name | [(E)-4-[[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-dimethyl-[(2-methyl-5-nitro-3H-pyrrol-4-yl)methyl]azanium |
|---|---|
| PubChem CID | 163437650 |
| Molecular Formula | C31H31ClN9O4+ |
| Molecular Weight | 629.10 g/mol |
| Exact Mass | 628.22 |
| IUPAC Name | [(E)-4-[[4-[3-chloro-4-(pyridin-2-ylmethoxy)anilino]pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-dimethyl-[(2-methyl-5-nitro-3H-pyrrol-4-yl)methyl]azanium |
| SMILES | CC1=NC([N+](=O)[O-])=C(C[N+](C)(C)C/C=C/C(=O)Nc2cc3c(Nc4ccc(OCc5ccccn5)c(Cl)c4)ncnc3cn2)C1 |
| InChI | InChI=1S/C31H30ClN9O4/c1-20-13-21(31(37-20)40(43)44)17-41(2,3)12-6-8-29(42)39-28-15-24-26(16-34-28)35-19-36-30(24)38-22-9-10-27(25(32)14-22)45-18-23-7-4-5-11-33-23/h4-11,14-16,19H,12-13,17-18H2,1-3H3,(H-,34,35,36,38,39,42)/p+1/b8-6+ |
| InChIKey | ILWWNHCQPSLURX-SOFGYWHQSA-O |
| XLogP | 5.32 |
| TPSA | 157.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.10 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|