C26H26BrClN7O3+ — CID 161044631
[(E)-5-[4-(3-bromo-4-chloroanilino)pyrido[3,4-d]pyrimidin-6-yl]-4-oxopent-2-enyl]-dimethyl-[(2-methyl-5-nitro-3H-pyrrol-4-yl)methyl]azanium (PubChem CID 161044631) has the molecular formula C26H26BrClN7O3+ and a molecular weight of 599.90 g/mol. Its IUPAC name is [(E)-5-[4-(3-bromo-4-chloroanilino)pyrido[3,4-d]pyrimidin-6-yl]-4-oxopent-2-enyl]-dimethyl-[(2-methyl-5-nitro-3H-pyrrol-4-yl)methyl]azanium.
| Compound Name | [(E)-5-[4-(3-bromo-4-chloroanilino)pyrido[3,4-d]pyrimidin-6-yl]-4-oxopent-2-enyl]-dimethyl-[(2-methyl-5-nitro-3H-pyrrol-4-yl)methyl]azanium |
|---|---|
| PubChem CID | 161044631 |
| Molecular Formula | C26H26BrClN7O3+ |
| Molecular Weight | 599.90 g/mol |
| Exact Mass | 598.10 |
| IUPAC Name | [(E)-5-[4-(3-bromo-4-chloroanilino)pyrido[3,4-d]pyrimidin-6-yl]-4-oxopent-2-enyl]-dimethyl-[(2-methyl-5-nitro-3H-pyrrol-4-yl)methyl]azanium |
| SMILES | CC1=NC([N+](=O)[O-])=C(C[N+](C)(C)C/C=C/C(=O)Cc2cc3c(Nc4ccc(Cl)c(Br)c4)ncnc3cn2)C1 |
| InChI | InChI=1S/C26H26BrClN7O3/c1-16-9-17(26(32-16)34(37)38)14-35(2,3)8-4-5-20(36)10-19-11-21-24(13-29-19)30-15-31-25(21)33-18-6-7-23(28)22(27)12-18/h4-7,11-13,15H,8-10,14H2,1-3H3,(H,30,31,33)/q+1/b5-4+ |
| InChIKey | NRZOXPIWSRRFGT-SNAWJCMRSA-N |
| XLogP | 5.28 |
| TPSA | 123.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.90 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|