C25H23BrFN10O3+ — CID 51038328
[(E)-4-[[4-(4-bromo-3-fluoroanilino)pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-[(2-cyano-3-methyl-5-nitroimidazol-4-yl)methyl]-dimethylazanium (PubChem CID 51038328) has the molecular formula C25H23BrFN10O3+ and a molecular weight of 610.43 g/mol. Its IUPAC name is [(E)-4-[[4-(4-bromo-3-fluoroanilino)pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-[(2-cyano-3-methyl-5-nitroimidazol-4-yl)methyl]-dimethylazanium.
| Compound Name | [(E)-4-[[4-(4-bromo-3-fluoroanilino)pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-[(2-cyano-3-methyl-5-nitroimidazol-4-yl)methyl]-dimethylazanium |
|---|---|
| PubChem CID | 51038328 |
| Molecular Formula | C25H23BrFN10O3+ |
| Molecular Weight | 610.43 g/mol |
| Exact Mass | 609.11 |
| IUPAC Name | [(E)-4-[[4-(4-bromo-3-fluoroanilino)pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-[(2-cyano-3-methyl-5-nitroimidazol-4-yl)methyl]-dimethylazanium |
| SMILES | Cn1c(C#N)nc([N+](=O)[O-])c1C[N+](C)(C)C/C=C/C(=O)Nc1cc2c(Nc3ccc(Br)c(F)c3)ncnc2cn1 |
| InChI | InChI=1S/C25H22BrFN10O3/c1-35-20(25(36(39)40)34-22(35)11-28)13-37(2,3)8-4-5-23(38)33-21-10-16-19(12-29-21)30-14-31-24(16)32-15-6-7-17(26)18(27)9-15/h4-7,9-10,12,14H,8,13H2,1-3H3,(H-,29,30,31,32,33,38)/p+1/b5-4+ |
| InChIKey | JHJCSWMYAWDAMI-SNAWJCMRSA-O |
| XLogP | 3.95 |
| TPSA | 164.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.43 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|