C28H27N10O3+ — CID 75244058
[3-(2-cyanoethyl)-5-nitroimidazol-4-yl]methyl-[4-[[4-(3-ethynylanilino)pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-dimethylazanium (PubChem CID 75244058) has the molecular formula C28H27N10O3+ and a molecular weight of 551.59 g/mol. Its IUPAC name is [3-(2-cyanoethyl)-5-nitroimidazol-4-yl]methyl-[4-[[4-(3-ethynylanilino)pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-dimethylazanium.
| Compound Name | [3-(2-cyanoethyl)-5-nitroimidazol-4-yl]methyl-[4-[[4-(3-ethynylanilino)pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-dimethylazanium |
|---|---|
| PubChem CID | 75244058 |
| Molecular Formula | C28H27N10O3+ |
| Molecular Weight | 551.59 g/mol |
| Exact Mass | 551.23 |
| IUPAC Name | [3-(2-cyanoethyl)-5-nitroimidazol-4-yl]methyl-[4-[[4-(3-ethynylanilino)pyrido[3,4-d]pyrimidin-6-yl]amino]-4-oxobut-2-enyl]-dimethylazanium |
| SMILES | C#Cc1cccc(Nc2ncnc3cnc(NC(=O)C=CC[N+](C)(C)Cc4c([N+](=O)[O-])ncn4CCC#N)cc23)c1 |
| InChI | InChI=1S/C28H26N10O3/c1-4-20-8-5-9-21(14-20)34-27-22-15-25(30-16-23(22)31-18-32-27)35-26(39)10-6-13-38(2,3)17-24-28(37(40)41)33-19-36(24)12-7-11-29/h1,5-6,8-10,14-16,18-19H,7,12-13,17H2,2-3H3,(H-,30,31,32,34,35,39)/p+1 |
| InChIKey | IUTKAACZHIEPFD-UHFFFAOYSA-O |
| XLogP | 3.54 |
| TPSA | 164.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.59 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|