C22H27N5O2 — CID 10834412
4-N-(3-methylphenyl)-7-(3-morpholin-4-ylpropoxy)quinazoline-4,6-diamine (PubChem CID 10834412) has the molecular formula C22H27N5O2 and a molecular weight of 393.49 g/mol. Its IUPAC name is 4-N-(3-methylphenyl)-7-(3-morpholin-4-ylpropoxy)quinazoline-4,6-diamine.
| Compound Name | 4-N-(3-methylphenyl)-7-(3-morpholin-4-ylpropoxy)quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 10834412 |
| Molecular Formula | C22H27N5O2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 4-N-(3-methylphenyl)-7-(3-morpholin-4-ylpropoxy)quinazoline-4,6-diamine |
| SMILES | Cc1cccc(Nc2ncnc3cc(OCCCN4CCOCC4)c(N)cc23)c1 |
| InChI | InChI=1S/C22H27N5O2/c1-16-4-2-5-17(12-16)26-22-18-13-19(23)21(14-20(18)24-15-25-22)29-9-3-6-27-7-10-28-11-8-27/h2,4-5,12-15H,3,6-11,23H2,1H3,(H,24,25,26) |
| InChIKey | JPTWUJWJRRBJGM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 85.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|