C23H30N6O — CID 57283012
4-N-(3-methylphenyl)-7-[1-(4-methylpiperazin-1-yl)propoxy]quinazoline-4,6-diamine (PubChem CID 57283012) has the molecular formula C23H30N6O and a molecular weight of 406.53 g/mol. Its IUPAC name is 4-N-(3-methylphenyl)-7-[1-(4-methylpiperazin-1-yl)propoxy]quinazoline-4,6-diamine.
| Compound Name | 4-N-(3-methylphenyl)-7-[1-(4-methylpiperazin-1-yl)propoxy]quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 57283012 |
| Molecular Formula | C23H30N6O |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | 4-N-(3-methylphenyl)-7-[1-(4-methylpiperazin-1-yl)propoxy]quinazoline-4,6-diamine |
| SMILES | CCC(Oc1cc2ncnc(Nc3cccc(C)c3)c2cc1N)N1CCN(C)CC1 |
| InChI | InChI=1S/C23H30N6O/c1-4-22(29-10-8-28(3)9-11-29)30-21-14-20-18(13-19(21)24)23(26-15-25-20)27-17-7-5-6-16(2)12-17/h5-7,12-15,22H,4,8-11,24H2,1-3H3,(H,25,26,27) |
| InChIKey | CYWWYWYPYCXKGG-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|