C28H33ClN6O4 — CID 174446103
ethyl 2-[4-[3-[2-amino-4-(3-chlorophenyl)-6-(prop-2-enoylamino)quinazolin-7-yl]oxypropyl]piperazin-1-yl]acetate (PubChem CID 174446103) has the molecular formula C28H33ClN6O4 and a molecular weight of 553.06 g/mol. Its IUPAC name is ethyl 2-[4-[3-[2-amino-4-(3-chlorophenyl)-6-(prop-2-enoylamino)quinazolin-7-yl]oxypropyl]piperazin-1-yl]acetate.
| Compound Name | ethyl 2-[4-[3-[2-amino-4-(3-chlorophenyl)-6-(prop-2-enoylamino)quinazolin-7-yl]oxypropyl]piperazin-1-yl]acetate |
|---|---|
| PubChem CID | 174446103 |
| Molecular Formula | C28H33ClN6O4 |
| Molecular Weight | 553.06 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | ethyl 2-[4-[3-[2-amino-4-(3-chlorophenyl)-6-(prop-2-enoylamino)quinazolin-7-yl]oxypropyl]piperazin-1-yl]acetate |
| SMILES | C=CC(=O)Nc1cc2c(-c3cccc(Cl)c3)nc(N)nc2cc1OCCCN1CCN(CC(=O)OCC)CC1 |
| InChI | InChI=1S/C28H33ClN6O4/c1-3-25(36)31-23-16-21-22(32-28(30)33-27(21)19-7-5-8-20(29)15-19)17-24(23)39-14-6-9-34-10-12-35(13-11-34)18-26(37)38-4-2/h3,5,7-8,15-17H,1,4,6,9-14,18H2,2H3,(H,31,36)(H2,30,32,33) |
| InChIKey | PGFFDTZGUSDCDM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.06 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|