C28H34N4O2 — CID 44564437
N-[4-[(3-methylphenyl)methyl]-7-[3-(4-methylpiperidin-1-yl)propoxy]quinazolin-6-yl]prop-2-enamide (PubChem CID 44564437) has the molecular formula C28H34N4O2 and a molecular weight of 458.61 g/mol. Its IUPAC name is N-[4-[(3-methylphenyl)methyl]-7-[3-(4-methylpiperidin-1-yl)propoxy]quinazolin-6-yl]prop-2-enamide.
| Compound Name | N-[4-[(3-methylphenyl)methyl]-7-[3-(4-methylpiperidin-1-yl)propoxy]quinazolin-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 44564437 |
| Molecular Formula | C28H34N4O2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | N-[4-[(3-methylphenyl)methyl]-7-[3-(4-methylpiperidin-1-yl)propoxy]quinazolin-6-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc2c(Cc3cccc(C)c3)ncnc2cc1OCCCN1CCC(C)CC1 |
| InChI | InChI=1S/C28H34N4O2/c1-4-28(33)31-26-17-23-24(16-22-8-5-7-21(3)15-22)29-19-30-25(23)18-27(26)34-14-6-11-32-12-9-20(2)10-13-32/h4-5,7-8,15,17-20H,1,6,9-14,16H2,2-3H3,(H,31,33) |
| InChIKey | HXIMPRFYWNJHQN-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|