C30H37N5O4 — CID 56974187
methyl 1-[1-[4-(1-phenylethylamino)-6-(prop-2-enoylamino)quinazolin-7-yl]oxybutyl]piperidine-2-carboxylate (PubChem CID 56974187) has the molecular formula C30H37N5O4 and a molecular weight of 531.66 g/mol. Its IUPAC name is methyl 1-[1-[4-(1-phenylethylamino)-6-(prop-2-enoylamino)quinazolin-7-yl]oxybutyl]piperidine-2-carboxylate.
| Compound Name | methyl 1-[1-[4-(1-phenylethylamino)-6-(prop-2-enoylamino)quinazolin-7-yl]oxybutyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 56974187 |
| Molecular Formula | C30H37N5O4 |
| Molecular Weight | 531.66 g/mol |
| Exact Mass | 531.28 |
| IUPAC Name | methyl 1-[1-[4-(1-phenylethylamino)-6-(prop-2-enoylamino)quinazolin-7-yl]oxybutyl]piperidine-2-carboxylate |
| SMILES | C=CC(=O)Nc1cc2c(NC(C)c3ccccc3)ncnc2cc1OC(CCC)N1CCCCC1C(=O)OC |
| InChI | InChI=1S/C30H37N5O4/c1-5-12-28(35-16-11-10-15-25(35)30(37)38-4)39-26-18-23-22(17-24(26)34-27(36)6-2)29(32-19-31-23)33-20(3)21-13-8-7-9-14-21/h6-9,13-14,17-20,25,28H,2,5,10-12,15-16H2,1,3-4H3,(H,34,36)(H,31,32,33) |
| InChIKey | DHGFBYCSSYYZNZ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 105.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.66 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|