C25H31N5O3 — CID 22269954
methyl 1-[3-[6-amino-4-(1-phenylethylamino)quinazolin-7-yl]oxypropyl]pyrrolidine-2-carboxylate (PubChem CID 22269954) has the molecular formula C25H31N5O3 and a molecular weight of 449.56 g/mol. Its IUPAC name is methyl 1-[3-[6-amino-4-(1-phenylethylamino)quinazolin-7-yl]oxypropyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl 1-[3-[6-amino-4-(1-phenylethylamino)quinazolin-7-yl]oxypropyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 22269954 |
| Molecular Formula | C25H31N5O3 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | methyl 1-[3-[6-amino-4-(1-phenylethylamino)quinazolin-7-yl]oxypropyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CCCN1CCCOc1cc2ncnc(NC(C)c3ccccc3)c2cc1N |
| InChI | InChI=1S/C25H31N5O3/c1-17(18-8-4-3-5-9-18)29-24-19-14-20(26)23(15-21(19)27-16-28-24)33-13-7-12-30-11-6-10-22(30)25(31)32-2/h3-5,8-9,14-17,22H,6-7,10-13,26H2,1-2H3,(H,27,28,29) |
| InChIKey | RTRUVSVFBMYROX-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 102.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|