C25H29N5O5 — CID 123856055
methyl 1-[1-[6-nitro-4-(1-phenylethylamino)quinazolin-7-yl]oxypropyl]pyrrolidine-2-carboxylate (PubChem CID 123856055) has the molecular formula C25H29N5O5 and a molecular weight of 479.54 g/mol. Its IUPAC name is methyl 1-[1-[6-nitro-4-(1-phenylethylamino)quinazolin-7-yl]oxypropyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl 1-[1-[6-nitro-4-(1-phenylethylamino)quinazolin-7-yl]oxypropyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 123856055 |
| Molecular Formula | C25H29N5O5 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | methyl 1-[1-[6-nitro-4-(1-phenylethylamino)quinazolin-7-yl]oxypropyl]pyrrolidine-2-carboxylate |
| SMILES | CCC(Oc1cc2ncnc(NC(C)c3ccccc3)c2cc1[N+](=O)[O-])N1CCCC1C(=O)OC |
| InChI | InChI=1S/C25H29N5O5/c1-4-23(29-12-8-11-20(29)25(31)34-3)35-22-14-19-18(13-21(22)30(32)33)24(27-15-26-19)28-16(2)17-9-6-5-7-10-17/h5-7,9-10,13-16,20,23H,4,8,11-12H2,1-3H3,(H,26,27,28) |
| InChIKey | SPXLPFHIQHWYKB-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 119.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|