C24H25ClFN5O3 — CID 91019719
N-[2-(3-chloro-4-fluoroanilino)-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]-4-(dimethylamino)but-2-enamide (PubChem CID 91019719) has the molecular formula C24H25ClFN5O3 and a molecular weight of 485.95 g/mol. Its IUPAC name is N-[2-(3-chloro-4-fluoroanilino)-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]-4-(dimethylamino)but-2-enamide.
| Compound Name | N-[2-(3-chloro-4-fluoroanilino)-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]-4-(dimethylamino)but-2-enamide |
|---|---|
| PubChem CID | 91019719 |
| Molecular Formula | C24H25ClFN5O3 |
| Molecular Weight | 485.95 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | N-[2-(3-chloro-4-fluoroanilino)-7-[(3S)-oxolan-3-yl]oxyquinazolin-6-yl]-4-(dimethylamino)but-2-enamide |
| SMILES | CN(C)CC=CC(=O)Nc1cc2cnc(Nc3ccc(F)c(Cl)c3)nc2cc1O[C@H]1CCOC1 |
| InChI | InChI=1S/C24H25ClFN5O3/c1-31(2)8-3-4-23(32)29-21-10-15-13-27-24(28-16-5-6-19(26)18(25)11-16)30-20(15)12-22(21)34-17-7-9-33-14-17/h3-6,10-13,17H,7-9,14H2,1-2H3,(H,29,32)(H,27,28,30)/t17-/m0/s1 |
| InChIKey | HJVPEGOGMWVRAY-KRWDZBQOSA-N |
| XLogP | 4.39 |
| TPSA | 88.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.95 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|