C26H26ClFN4O4S — CID 159800164
(E)-1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]-5-(5,5-dioxo-2,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrol-1-yl)pent-3-en-2-one (PubChem CID 159800164) has the molecular formula C26H26ClFN4O4S and a molecular weight of 545.04 g/mol. Its IUPAC name is (E)-1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]-5-(5,5-dioxo-2,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrol-1-yl)pent-3-en-2-one.
| Compound Name | (E)-1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]-5-(5,5-dioxo-2,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrol-1-yl)pent-3-en-2-one |
|---|---|
| PubChem CID | 159800164 |
| Molecular Formula | C26H26ClFN4O4S |
| Molecular Weight | 545.04 g/mol |
| Exact Mass | 544.13 |
| IUPAC Name | (E)-1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]-5-(5,5-dioxo-2,3,3a,4,6,6a-hexahydrothieno[3,4-b]pyrrol-1-yl)pent-3-en-2-one |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1CC(=O)/C=C/CN1CCC2CS(=O)(=O)CC21 |
| InChI | InChI=1S/C26H26ClFN4O4S/c1-36-25-12-23-20(26(30-15-29-23)31-18-4-5-22(28)21(27)11-18)10-17(25)9-19(33)3-2-7-32-8-6-16-13-37(34,35)14-24(16)32/h2-5,10-12,15-16,24H,6-9,13-14H2,1H3,(H,29,30,31)/b3-2+ |
| InChIKey | NJRKWUMGHFUFPK-NSCUHMNNSA-N |
| XLogP | 3.96 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.04 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|