C29H35ClFN5O2 — CID 167578570
(E)-5-[4-(tert-butylamino)piperidin-1-yl]-1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]pent-3-en-2-one (PubChem CID 167578570) has the molecular formula C29H35ClFN5O2 and a molecular weight of 540.08 g/mol. Its IUPAC name is (E)-5-[4-(tert-butylamino)piperidin-1-yl]-1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]pent-3-en-2-one.
| Compound Name | (E)-5-[4-(tert-butylamino)piperidin-1-yl]-1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]pent-3-en-2-one |
|---|---|
| PubChem CID | 167578570 |
| Molecular Formula | C29H35ClFN5O2 |
| Molecular Weight | 540.08 g/mol |
| Exact Mass | 539.25 |
| IUPAC Name | (E)-5-[4-(tert-butylamino)piperidin-1-yl]-1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]pent-3-en-2-one |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1CC(=O)/C=C/CN1CCC(NC(C)(C)C)CC1 |
| InChI | InChI=1S/C29H35ClFN5O2/c1-29(2,3)35-20-9-12-36(13-10-20)11-5-6-22(37)14-19-15-23-26(17-27(19)38-4)32-18-33-28(23)34-21-7-8-25(31)24(30)16-21/h5-8,15-18,20,35H,9-14H2,1-4H3,(H,32,33,34)/b6-5+ |
| InChIKey | KJHICIRWVQIKSH-AATRIKPKSA-N |
| XLogP | 5.69 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.08 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|