C27H28ClFN4O3 — CID 158496944
(E)-5-(3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl)-1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]pent-3-en-2-one (PubChem CID 158496944) has the molecular formula C27H28ClFN4O3 and a molecular weight of 511.00 g/mol. Its IUPAC name is (E)-5-(3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl)-1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]pent-3-en-2-one.
| Compound Name | (E)-5-(3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl)-1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]pent-3-en-2-one |
|---|---|
| PubChem CID | 158496944 |
| Molecular Formula | C27H28ClFN4O3 |
| Molecular Weight | 511.00 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | (E)-5-(3,3a,4,6,7,7a-hexahydro-1H-furo[3,4-c]pyridin-5-yl)-1-[4-(3-chloro-4-fluoroanilino)-7-methoxyquinazolin-6-yl]pent-3-en-2-one |
| SMILES | COc1cc2ncnc(Nc3ccc(F)c(Cl)c3)c2cc1CC(=O)/C=C/CN1CCC2COCC2C1 |
| InChI | InChI=1S/C27H28ClFN4O3/c1-35-26-12-25-22(27(31-16-30-25)32-20-4-5-24(29)23(28)11-20)10-18(26)9-21(34)3-2-7-33-8-6-17-14-36-15-19(17)13-33/h2-5,10-12,16-17,19H,6-9,13-15H2,1H3,(H,30,31,32)/b3-2+ |
| InChIKey | HJKHDBYDRCNFMJ-NSCUHMNNSA-N |
| XLogP | 4.81 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.00 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|