C30H33FN4O6S — CID 158219650
(E)-5-(2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl)-1-[7-(1,1-dioxothiolan-3-yl)oxy-4-(4-fluoro-3-methylanilino)quinazolin-6-yl]pent-3-en-2-one (PubChem CID 158219650) has the molecular formula C30H33FN4O6S and a molecular weight of 596.68 g/mol. Its IUPAC name is (E)-5-(2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl)-1-[7-(1,1-dioxothiolan-3-yl)oxy-4-(4-fluoro-3-methylanilino)quinazolin-6-yl]pent-3-en-2-one.
| Compound Name | (E)-5-(2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl)-1-[7-(1,1-dioxothiolan-3-yl)oxy-4-(4-fluoro-3-methylanilino)quinazolin-6-yl]pent-3-en-2-one |
|---|---|
| PubChem CID | 158219650 |
| Molecular Formula | C30H33FN4O6S |
| Molecular Weight | 596.68 g/mol |
| Exact Mass | 596.21 |
| IUPAC Name | (E)-5-(2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl)-1-[7-(1,1-dioxothiolan-3-yl)oxy-4-(4-fluoro-3-methylanilino)quinazolin-6-yl]pent-3-en-2-one |
| SMILES | Cc1cc(Nc2ncnc3cc(OC4CCS(=O)(=O)C4)c(CC(=O)/C=C/CN4CC5OCCOC5C4)cc23)ccc1F |
| InChI | InChI=1S/C30H33FN4O6S/c1-19-11-21(4-5-25(19)31)34-30-24-13-20(12-22(36)3-2-7-35-15-28-29(16-35)40-9-8-39-28)27(14-26(24)32-18-33-30)41-23-6-10-42(37,38)17-23/h2-5,11,13-14,18,23,28-29H,6-10,12,15-17H2,1H3,(H,32,33,34)/b3-2+ |
| InChIKey | LYKIRJAEKAMSNX-NSCUHMNNSA-N |
| XLogP | 3.15 |
| TPSA | 119.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.68 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|