C34H37N7O6 — CID 88854674
tert-butyl 5-[[7-methoxy-6-(3-morpholin-4-ylpropoxy)-2-(3-nitrosophenyl)quinazolin-4-yl]amino]indazole-1-carboxylate (PubChem CID 88854674) has the molecular formula C34H37N7O6 and a molecular weight of 639.71 g/mol. Its IUPAC name is tert-butyl 5-[[7-methoxy-6-(3-morpholin-4-ylpropoxy)-2-(3-nitrosophenyl)quinazolin-4-yl]amino]indazole-1-carboxylate.
| Compound Name | tert-butyl 5-[[7-methoxy-6-(3-morpholin-4-ylpropoxy)-2-(3-nitrosophenyl)quinazolin-4-yl]amino]indazole-1-carboxylate |
|---|---|
| PubChem CID | 88854674 |
| Molecular Formula | C34H37N7O6 |
| Molecular Weight | 639.71 g/mol |
| Exact Mass | 639.28 |
| IUPAC Name | tert-butyl 5-[[7-methoxy-6-(3-morpholin-4-ylpropoxy)-2-(3-nitrosophenyl)quinazolin-4-yl]amino]indazole-1-carboxylate |
| SMILES | COc1cc2nc(-c3cccc(N=O)c3)nc(Nc3ccc4c(cnn4C(=O)OC(C)(C)C)c3)c2cc1OCCCN1CCOCC1 |
| InChI | InChI=1S/C34H37N7O6/c1-34(2,3)47-33(42)41-28-10-9-24(18-23(28)21-35-41)36-32-26-19-30(46-14-6-11-40-12-15-45-16-13-40)29(44-4)20-27(26)37-31(38-32)22-7-5-8-25(17-22)39-43/h5,7-10,17-21H,6,11-16H2,1-4H3,(H,36,37,38) |
| InChIKey | BDAFDMOYLWOAOY-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 142.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.71 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|