C24H18N6O4 — CID 67134871
5-[[6-acetyloxy-2-(3-aminophenyl)quinazolin-4-yl]amino]indazole-1-carboxylic acid (PubChem CID 67134871) has the molecular formula C24H18N6O4 and a molecular weight of 454.45 g/mol. Its IUPAC name is 5-[[6-acetyloxy-2-(3-aminophenyl)quinazolin-4-yl]amino]indazole-1-carboxylic acid.
| Compound Name | 5-[[6-acetyloxy-2-(3-aminophenyl)quinazolin-4-yl]amino]indazole-1-carboxylic acid |
|---|---|
| PubChem CID | 67134871 |
| Molecular Formula | C24H18N6O4 |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | 5-[[6-acetyloxy-2-(3-aminophenyl)quinazolin-4-yl]amino]indazole-1-carboxylic acid |
| SMILES | CC(=O)Oc1ccc2nc(-c3cccc(N)c3)nc(Nc3ccc4c(cnn4C(=O)O)c3)c2c1 |
| InChI | InChI=1S/C24H18N6O4/c1-13(31)34-18-6-7-20-19(11-18)23(29-22(28-20)14-3-2-4-16(25)9-14)27-17-5-8-21-15(10-17)12-26-30(21)24(32)33/h2-12H,25H2,1H3,(H,32,33)(H,27,28,29) |
| InChIKey | HRFCBYUIUAGCGS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 145.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|