C24H21ClFN5O3 — CID 89347895
4-(3-chloro-4-fluoroanilino)-N-(2,2-dimethoxyethyl)-2-pyridin-3-ylquinazoline-6-carboxamide (PubChem CID 89347895) has the molecular formula C24H21ClFN5O3 and a molecular weight of 481.92 g/mol. Its IUPAC name is 4-(3-chloro-4-fluoroanilino)-N-(2,2-dimethoxyethyl)-2-pyridin-3-ylquinazoline-6-carboxamide.
| Compound Name | 4-(3-chloro-4-fluoroanilino)-N-(2,2-dimethoxyethyl)-2-pyridin-3-ylquinazoline-6-carboxamide |
|---|---|
| PubChem CID | 89347895 |
| Molecular Formula | C24H21ClFN5O3 |
| Molecular Weight | 481.92 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | 4-(3-chloro-4-fluoroanilino)-N-(2,2-dimethoxyethyl)-2-pyridin-3-ylquinazoline-6-carboxamide |
| SMILES | COC(CNC(=O)c1ccc2nc(-c3cccnc3)nc(Nc3ccc(F)c(Cl)c3)c2c1)OC |
| InChI | InChI=1S/C24H21ClFN5O3/c1-33-21(34-2)13-28-24(32)14-5-8-20-17(10-14)23(29-16-6-7-19(26)18(25)11-16)31-22(30-20)15-4-3-9-27-12-15/h3-12,21H,13H2,1-2H3,(H,28,32)(H,29,30,31) |
| InChIKey | NEJFXYLMWXJSEM-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 98.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.92 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|