C27H23ClN4O2 — CID 144500793
3-chloro-N-[6-[(2E,4Z)-1-methoxyhexa-2,4-dien-3-yl]-2-pyridin-3-ylquinazolin-4-yl]benzamide (PubChem CID 144500793) has the molecular formula C27H23ClN4O2 and a molecular weight of 470.96 g/mol. Its IUPAC name is 3-chloro-N-[6-[(2E,4Z)-1-methoxyhexa-2,4-dien-3-yl]-2-pyridin-3-ylquinazolin-4-yl]benzamide.
| Compound Name | 3-chloro-N-[6-[(2E,4Z)-1-methoxyhexa-2,4-dien-3-yl]-2-pyridin-3-ylquinazolin-4-yl]benzamide |
|---|---|
| PubChem CID | 144500793 |
| Molecular Formula | C27H23ClN4O2 |
| Molecular Weight | 470.96 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 3-chloro-N-[6-[(2E,4Z)-1-methoxyhexa-2,4-dien-3-yl]-2-pyridin-3-ylquinazolin-4-yl]benzamide |
| SMILES | C/C=C\C(=C/COC)c1ccc2nc(-c3cccnc3)nc(NC(=O)c3cccc(Cl)c3)c2c1 |
| InChI | InChI=1S/C27H23ClN4O2/c1-3-6-18(12-14-34-2)19-10-11-24-23(16-19)26(31-25(30-24)21-8-5-13-29-17-21)32-27(33)20-7-4-9-22(28)15-20/h3-13,15-17H,14H2,1-2H3,(H,30,31,32,33)/b6-3-,18-12+ |
| InChIKey | PTVCCRWOEHXWKR-GTNJKDTHSA-N |
| XLogP | 6.20 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.96 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|