C19H13ClN4O2S — CID 71274429
methyl 2-[(6-chloro-2-pyridin-3-ylquinazolin-4-yl)amino]thiophene-3-carboxylate (PubChem CID 71274429) has the molecular formula C19H13ClN4O2S and a molecular weight of 396.86 g/mol. Its IUPAC name is methyl 2-[(6-chloro-2-pyridin-3-ylquinazolin-4-yl)amino]thiophene-3-carboxylate.
| Compound Name | methyl 2-[(6-chloro-2-pyridin-3-ylquinazolin-4-yl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 71274429 |
| Molecular Formula | C19H13ClN4O2S |
| Molecular Weight | 396.86 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | methyl 2-[(6-chloro-2-pyridin-3-ylquinazolin-4-yl)amino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1ccsc1Nc1nc(-c2cccnc2)nc2ccc(Cl)cc12 |
| InChI | InChI=1S/C19H13ClN4O2S/c1-26-19(25)13-6-8-27-18(13)24-17-14-9-12(20)4-5-15(14)22-16(23-17)11-3-2-7-21-10-11/h2-10H,1H3,(H,22,23,24) |
| InChIKey | FAWJYCODTZENPQ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.86 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |