C23H14ClFN4S — CID 71274188
N-(3-chloro-4-fluorophenyl)-2-pyridin-3-yl-6-thiophen-2-ylquinazolin-4-amine (PubChem CID 71274188) has the molecular formula C23H14ClFN4S and a molecular weight of 432.91 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-2-pyridin-3-yl-6-thiophen-2-ylquinazolin-4-amine.
| Compound Name | N-(3-chloro-4-fluorophenyl)-2-pyridin-3-yl-6-thiophen-2-ylquinazolin-4-amine |
|---|---|
| PubChem CID | 71274188 |
| Molecular Formula | C23H14ClFN4S |
| Molecular Weight | 432.91 g/mol |
| Exact Mass | 432.06 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-2-pyridin-3-yl-6-thiophen-2-ylquinazolin-4-amine |
| SMILES | Fc1ccc(Nc2nc(-c3cccnc3)nc3ccc(-c4cccs4)cc23)cc1Cl |
| InChI | InChI=1S/C23H14ClFN4S/c24-18-12-16(6-7-19(18)25)27-23-17-11-14(21-4-2-10-30-21)5-8-20(17)28-22(29-23)15-3-1-9-26-13-15/h1-13H,(H,27,28,29) |
| InChIKey | NADPKCQQSYBPJZ-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.91 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |