C23H15ClFN5 — CID 67298078
4-[4-(3-chloro-4-fluoroanilino)-2-pyridin-3-ylquinazolin-6-yl]but-3-enenitrile (PubChem CID 67298078) has the molecular formula C23H15ClFN5 and a molecular weight of 415.86 g/mol. Its IUPAC name is 4-[4-(3-chloro-4-fluoroanilino)-2-pyridin-3-ylquinazolin-6-yl]but-3-enenitrile.
| Compound Name | 4-[4-(3-chloro-4-fluoroanilino)-2-pyridin-3-ylquinazolin-6-yl]but-3-enenitrile |
|---|---|
| PubChem CID | 67298078 |
| Molecular Formula | C23H15ClFN5 |
| Molecular Weight | 415.86 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 4-[4-(3-chloro-4-fluoroanilino)-2-pyridin-3-ylquinazolin-6-yl]but-3-enenitrile |
| SMILES | N#CCC=Cc1ccc2nc(-c3cccnc3)nc(Nc3ccc(F)c(Cl)c3)c2c1 |
| InChI | InChI=1S/C23H15ClFN5/c24-19-13-17(7-8-20(19)25)28-23-18-12-15(4-1-2-10-26)6-9-21(18)29-22(30-23)16-5-3-11-27-14-16/h1,3-9,11-14H,2H2,(H,28,29,30) |
| InChIKey | WWKNYYMIQKXWNL-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.86 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |