C25H23ClFN5O2S — CID 144501243
4-(3-chloro-4-fluoroanilino)-2-pyridin-3-ylquinazoline-7-carbaldehyde;4-methyl-1,4-thiazinane 1-oxide (PubChem CID 144501243) has the molecular formula C25H23ClFN5O2S and a molecular weight of 512.01 g/mol. Its IUPAC name is 4-(3-chloro-4-fluoroanilino)-2-pyridin-3-ylquinazoline-7-carbaldehyde;4-methyl-1,4-thiazinane 1-oxide.
| Compound Name | 4-(3-chloro-4-fluoroanilino)-2-pyridin-3-ylquinazoline-7-carbaldehyde;4-methyl-1,4-thiazinane 1-oxide |
|---|---|
| PubChem CID | 144501243 |
| Molecular Formula | C25H23ClFN5O2S |
| Molecular Weight | 512.01 g/mol |
| Exact Mass | 511.12 |
| IUPAC Name | 4-(3-chloro-4-fluoroanilino)-2-pyridin-3-ylquinazoline-7-carbaldehyde;4-methyl-1,4-thiazinane 1-oxide |
| SMILES | CN1CCS(=O)CC1.O=Cc1ccc2c(Nc3ccc(F)c(Cl)c3)nc(-c3cccnc3)nc2c1 |
| InChI | InChI=1S/C20H12ClFN4O.C5H11NOS/c21-16-9-14(4-6-17(16)22)24-20-15-5-3-12(11-27)8-18(15)25-19(26-20)13-2-1-7-23-10-13;1-6-2-4-8(7)5-3-6/h1-11H,(H,24,25,26);2-5H2,1H3 |
| InChIKey | YNHWUMBKJYJSIO-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 88.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.01 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|