C23H20N6O3 — CID 67298170
2-[[6-[2-(methylamino)-2-oxoethoxy]-2-pyridin-3-ylquinazolin-4-yl]amino]benzamide (PubChem CID 67298170) has the molecular formula C23H20N6O3 and a molecular weight of 428.45 g/mol. Its IUPAC name is 2-[[6-[2-(methylamino)-2-oxoethoxy]-2-pyridin-3-ylquinazolin-4-yl]amino]benzamide.
| Compound Name | 2-[[6-[2-(methylamino)-2-oxoethoxy]-2-pyridin-3-ylquinazolin-4-yl]amino]benzamide |
|---|---|
| PubChem CID | 67298170 |
| Molecular Formula | C23H20N6O3 |
| Molecular Weight | 428.45 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 2-[[6-[2-(methylamino)-2-oxoethoxy]-2-pyridin-3-ylquinazolin-4-yl]amino]benzamide |
| SMILES | CNC(=O)COc1ccc2nc(-c3cccnc3)nc(Nc3ccccc3C(N)=O)c2c1 |
| InChI | InChI=1S/C23H20N6O3/c1-25-20(30)13-32-15-8-9-19-17(11-15)23(28-18-7-3-2-6-16(18)21(24)31)29-22(27-19)14-5-4-10-26-12-14/h2-12H,13H2,1H3,(H2,24,31)(H,25,30)(H,27,28,29) |
| InChIKey | OCTRCBXOYJIXNV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |